C24H26N2O4S — CID 22304966
N,N-dibenzyl-2-(2-methoxy-3-methylsulfonylanilino)acetamide (PubChem CID 22304966) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is N,N-dibenzyl-2-(2-methoxy-3-methylsulfonylanilino)acetamide.
| Compound Name | N,N-dibenzyl-2-(2-methoxy-3-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 22304966 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N,N-dibenzyl-2-(2-methoxy-3-methylsulfonylanilino)acetamide |
| SMILES | COc1c(NCC(=O)N(Cc2ccccc2)Cc2ccccc2)cccc1S(C)(=O)=O |
| InChI | InChI=1S/C24H26N2O4S/c1-30-24-21(14-9-15-22(24)31(2,28)29)25-16-23(27)26(17-19-10-5-3-6-11-19)18-20-12-7-4-8-13-20/h3-15,25H,16-18H2,1-2H3 |
| InChIKey | RPWMTJBORCZRPX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |