C23H25NO5S — CID 2230499
(5Z)-5-[[4-[3-(2,3-dimethylphenoxy)propoxy]-3-ethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 2230499) has the molecular formula C23H25NO5S and a molecular weight of 427.52 g/mol. Its IUPAC name is (5Z)-5-[[4-[3-(2,3-dimethylphenoxy)propoxy]-3-ethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[3-(2,3-dimethylphenoxy)propoxy]-3-ethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2230499 |
| Molecular Formula | C23H25NO5S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | (5Z)-5-[[4-[3-(2,3-dimethylphenoxy)propoxy]-3-ethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2\SC(=O)NC2=O)ccc1OCCCOc1cccc(C)c1C |
| InChI | InChI=1S/C23H25NO5S/c1-4-27-20-13-17(14-21-22(25)24-23(26)30-21)9-10-19(20)29-12-6-11-28-18-8-5-7-15(2)16(18)3/h5,7-10,13-14H,4,6,11-12H2,1-3H3,(H,24,25,26)/b21-14- |
| InChIKey | KAXXROGPPJOLMQ-STZFKDTASA-N |
| XLogP | 4.87 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|