C27H23FN2O3S2 — CID 22305034
2-[2-(benzenesulfonyl)-4-fluoroanilino]-N-[4-(phenylsulfanylmethyl)phenyl]acetamide (PubChem CID 22305034) has the molecular formula C27H23FN2O3S2 and a molecular weight of 506.62 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)-4-fluoroanilino]-N-[4-(phenylsulfanylmethyl)phenyl]acetamide.
| Compound Name | 2-[2-(benzenesulfonyl)-4-fluoroanilino]-N-[4-(phenylsulfanylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 22305034 |
| Molecular Formula | C27H23FN2O3S2 |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 2-[2-(benzenesulfonyl)-4-fluoroanilino]-N-[4-(phenylsulfanylmethyl)phenyl]acetamide |
| SMILES | O=C(CNc1ccc(F)cc1S(=O)(=O)c1ccccc1)Nc1ccc(CSc2ccccc2)cc1 |
| InChI | InChI=1S/C27H23FN2O3S2/c28-21-13-16-25(26(17-21)35(32,33)24-9-5-2-6-10-24)29-18-27(31)30-22-14-11-20(12-15-22)19-34-23-7-3-1-4-8-23/h1-17,29H,18-19H2,(H,30,31) |
| InChIKey | CEUNYHKRGWTOPA-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |