About 1-[(1,5-dimethylpyrazole-3-carbonyl)amino]-1-ethylthiourea
1-[(1,5-dimethylpyrazole-3-carbonyl)amino]-1-ethylthiourea (PubChem CID 22305911) has the molecular formula C9H15N5OS
and a molecular weight of 241.32 g/mol. Its IUPAC name is 1-[(1,5-dimethylpyrazole-3-carbonyl)amino]-1-ethylthiourea.
Molecular Properties
| Compound Name | 1-[(1,5-dimethylpyrazole-3-carbonyl)amino]-1-ethylthiourea |
| PubChem CID | 22305911 |
| Molecular Formula | C9H15N5OS |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 1-[(1,5-dimethylpyrazole-3-carbonyl)amino]-1-ethylthiourea |
| SMILES | CCN(NC(=O)c1cc(C)n(C)n1)C(N)=S |
| InChI | InChI=1S/C9H15N5OS/c1-4-14(9(10)16)12-8(15)7-5-6(2)13(3)11-7/h5H,4H2,1-3H3,(H2,10,16)(H,12,15) |
| InChIKey | UFYLBXFWLMYXFK-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1,5-dimethylpyrazole-3-carbonyl)amino]-1-ethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,5-dimethylpyrazole-3-carbonyl)amino]-1-ethylthiourea?
The IUPAC name of 1-[(1,5-dimethylpyrazole-3-carbonyl)amino]-1-ethylthiourea (CID 22305911) is 1-[(1,5-dimethylpyrazole-3-carbonyl)amino]-1-ethylthiourea.
What is the SMILES notation for 1-[(1,5-dimethylpyrazole-3-carbonyl)amino]-1-ethylthiourea?
The canonical SMILES for 1-[(1,5-dimethylpyrazole-3-carbonyl)amino]-1-ethylthiourea is CCN(NC(=O)c1cc(C)n(C)n1)C(N)=S.
What is the InChIKey of 1-[(1,5-dimethylpyrazole-3-carbonyl)amino]-1-ethylthiourea?
The InChIKey is UFYLBXFWLMYXFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5OS/c1-4-14(9(10)16)12-8(15)7-5-6(2)13(3)11-7/h5H,4H2,1-3H3,(H2,10,16)(H,12,15).
What are the key properties of 1-[(1,5-dimethylpyrazole-3-carbonyl)amino]-1-ethylthiourea?
1-[(1,5-dimethylpyrazole-3-carbonyl)amino]-1-ethylthiourea has a molecular weight of 241.32 g/mol, XLogP of -0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,5-dimethylpyrazole-3-carbonyl)amino]-1-ethylthiourea is sourced from PubChem (CID 22305911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).