About (3Z,5E)-1-acetyl-3,5-bis[(3-methylthiophen-2-yl)methylidene]piperidin-4-one
(3Z,5E)-1-acetyl-3,5-bis[(3-methylthiophen-2-yl)methylidene]piperidin-4-one (PubChem CID 22306176) has the molecular formula C19H19NO2S2
and a molecular weight of 357.50 g/mol. Its IUPAC name is (3Z,5E)-1-acetyl-3,5-bis[(3-methylthiophen-2-yl)methylidene]piperidin-4-one.
Molecular Properties
| Compound Name | (3Z,5E)-1-acetyl-3,5-bis[(3-methylthiophen-2-yl)methylidene]piperidin-4-one |
| PubChem CID | 22306176 |
| Molecular Formula | C19H19NO2S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | (3Z,5E)-1-acetyl-3,5-bis[(3-methylthiophen-2-yl)methylidene]piperidin-4-one |
| SMILES | CC(=O)N1C/C(=C/c2sccc2C)C(=O)/C(=C/c2sccc2C)C1 |
| InChI | InChI=1S/C19H19NO2S2/c1-12-4-6-23-17(12)8-15-10-20(14(3)21)11-16(19(15)22)9-18-13(2)5-7-24-18/h4-9H,10-11H2,1-3H3/b15-8-,16-9+ |
| InChIKey | RTRUVBWSNYDKHI-IZKYPSLPSA-N |
| XLogP | 4.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5E)-1-acetyl-3,5-bis[(3-methylthiophen-2-yl)methylidene]piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5E)-1-acetyl-3,5-bis[(3-methylthiophen-2-yl)methylidene]piperidin-4-one?
The IUPAC name of (3Z,5E)-1-acetyl-3,5-bis[(3-methylthiophen-2-yl)methylidene]piperidin-4-one (CID 22306176) is (3Z,5E)-1-acetyl-3,5-bis[(3-methylthiophen-2-yl)methylidene]piperidin-4-one.
What is the SMILES notation for (3Z,5E)-1-acetyl-3,5-bis[(3-methylthiophen-2-yl)methylidene]piperidin-4-one?
The canonical SMILES for (3Z,5E)-1-acetyl-3,5-bis[(3-methylthiophen-2-yl)methylidene]piperidin-4-one is CC(=O)N1C/C(=C/c2sccc2C)C(=O)/C(=C/c2sccc2C)C1.
What is the InChIKey of (3Z,5E)-1-acetyl-3,5-bis[(3-methylthiophen-2-yl)methylidene]piperidin-4-one?
The InChIKey is RTRUVBWSNYDKHI-IZKYPSLPSA-N. The full InChI is InChI=1S/C19H19NO2S2/c1-12-4-6-23-17(12)8-15-10-20(14(3)21)11-16(19(15)22)9-18-13(2)5-7-24-18/h4-9H,10-11H2,1-3H3/b15-8-,16-9+.
What are the key properties of (3Z,5E)-1-acetyl-3,5-bis[(3-methylthiophen-2-yl)methylidene]piperidin-4-one?
(3Z,5E)-1-acetyl-3,5-bis[(3-methylthiophen-2-yl)methylidene]piperidin-4-one has a molecular weight of 357.50 g/mol, XLogP of 4.32, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5E)-1-acetyl-3,5-bis[(3-methylthiophen-2-yl)methylidene]piperidin-4-one is sourced from PubChem (CID 22306176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).