C13H16O5 — CID 22306335
4,4-dimethyl-3,5,8,10-tetraoxatetracyclo[7.5.1.02,7.012,15]pentadec-12-en-14-one (PubChem CID 22306335) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is 4,4-dimethyl-3,5,8,10-tetraoxatetracyclo[7.5.1.02,7.012,15]pentadec-12-en-14-one.
| Compound Name | 4,4-dimethyl-3,5,8,10-tetraoxatetracyclo[7.5.1.02,7.012,15]pentadec-12-en-14-one |
|---|---|
| PubChem CID | 22306335 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 4,4-dimethyl-3,5,8,10-tetraoxatetracyclo[7.5.1.02,7.012,15]pentadec-12-en-14-one |
| SMILES | CC1(C)OCC2OC3OCC4=CC(=O)C(C2O1)C43 |
| InChI | InChI=1S/C13H16O5/c1-13(2)16-5-8-11(18-13)10-7(14)3-6-4-15-12(17-8)9(6)10/h3,8-12H,4-5H2,1-2H3 |
| InChIKey | WUPQHBSFJREWCT-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |