C23H24N2O6S — CID 22307621
2-[2-(3,4-dimethoxyphenyl)sulfonylanilino]-N-(4-methoxyphenyl)acetamide (PubChem CID 22307621) has the molecular formula C23H24N2O6S and a molecular weight of 456.52 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)sulfonylanilino]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)sulfonylanilino]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 22307621 |
| Molecular Formula | C23H24N2O6S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)sulfonylanilino]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CNc2ccccc2S(=O)(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H24N2O6S/c1-29-17-10-8-16(9-11-17)25-23(26)15-24-19-6-4-5-7-22(19)32(27,28)18-12-13-20(30-2)21(14-18)31-3/h4-14,24H,15H2,1-3H3,(H,25,26) |
| InChIKey | JGXHPSRPSRTEEV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |