C22H18N6S — CID 22307832
1-[(5,6-diphenyl-1,2,4-triazin-3-yl)amino]-1-phenylthiourea (PubChem CID 22307832) has the molecular formula C22H18N6S and a molecular weight of 398.50 g/mol. Its IUPAC name is 1-[(5,6-diphenyl-1,2,4-triazin-3-yl)amino]-1-phenylthiourea.
| Compound Name | 1-[(5,6-diphenyl-1,2,4-triazin-3-yl)amino]-1-phenylthiourea |
|---|---|
| PubChem CID | 22307832 |
| Molecular Formula | C22H18N6S |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 1-[(5,6-diphenyl-1,2,4-triazin-3-yl)amino]-1-phenylthiourea |
| SMILES | NC(=S)N(Nc1nnc(-c2ccccc2)c(-c2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C22H18N6S/c23-21(29)28(18-14-8-3-9-15-18)27-22-24-19(16-10-4-1-5-11-16)20(25-26-22)17-12-6-2-7-13-17/h1-15H,(H2,23,29)(H,24,26,27) |
| InChIKey | OTMPHJYWDJTKLW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|