C17H17N3O4S2 — CID 2230896
4-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide (PubChem CID 2230896) has the molecular formula C17H17N3O4S2 and a molecular weight of 391.47 g/mol. Its IUPAC name is 4-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 2230896 |
| Molecular Formula | C17H17N3O4S2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 4-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide |
| SMILES | COc1ccc(-c2csc(Nc3ccc(S(N)(=O)=O)cc3)n2)cc1OC |
| InChI | InChI=1S/C17H17N3O4S2/c1-23-15-8-3-11(9-16(15)24-2)14-10-25-17(20-14)19-12-4-6-13(7-5-12)26(18,21)22/h3-10H,1-2H3,(H,19,20)(H2,18,21,22) |
| InChIKey | DDDMHYSLQGZBGO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |