About 5-[(2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylic acid
5-[(2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylic acid (PubChem CID 22310107) has the molecular formula C22H17N3O3
and a molecular weight of 371.40 g/mol. Its IUPAC name is 5-[(2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylic acid |
| PubChem CID | 22310107 |
| Molecular Formula | C22H17N3O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 5-[(2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylic acid |
| SMILES | Cc1cc2nc3c4ccccc4n(Cc4ccc(C(=O)O)o4)c3nc2cc1C |
| InChI | InChI=1S/C22H17N3O3/c1-12-9-16-17(10-13(12)2)24-21-20(23-16)15-5-3-4-6-18(15)25(21)11-14-7-8-19(28-14)22(26)27/h3-10H,11H2,1-2H3,(H,26,27) |
| InChIKey | AFTXMTYRTVFCRY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylic acid?
The IUPAC name of 5-[(2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylic acid (CID 22310107) is 5-[(2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylic acid.
What is the SMILES notation for 5-[(2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylic acid?
The canonical SMILES for 5-[(2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylic acid is Cc1cc2nc3c4ccccc4n(Cc4ccc(C(=O)O)o4)c3nc2cc1C.
What is the InChIKey of 5-[(2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylic acid?
The InChIKey is AFTXMTYRTVFCRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N3O3/c1-12-9-16-17(10-13(12)2)24-21-20(23-16)15-5-3-4-6-18(15)25(21)11-14-7-8-19(28-14)22(26)27/h3-10H,11H2,1-2H3,(H,26,27).
What are the key properties of 5-[(2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylic acid?
5-[(2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylic acid has a molecular weight of 371.40 g/mol, XLogP of 4.69, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylic acid is sourced from PubChem (CID 22310107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).