C35H23N3O2 — CID 22310206
2-naphthalen-2-yl-5-[4-[(E)-2-[4-(5-phenyl-1,3-oxazol-2-yl)phenyl]ethenyl]phenyl]-1,3,4-oxadiazole (PubChem CID 22310206) has the molecular formula C35H23N3O2 and a molecular weight of 517.59 g/mol. Its IUPAC name is 2-naphthalen-2-yl-5-[4-[(E)-2-[4-(5-phenyl-1,3-oxazol-2-yl)phenyl]ethenyl]phenyl]-1,3,4-oxadiazole.
| Compound Name | 2-naphthalen-2-yl-5-[4-[(E)-2-[4-(5-phenyl-1,3-oxazol-2-yl)phenyl]ethenyl]phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 22310206 |
| Molecular Formula | C35H23N3O2 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | 2-naphthalen-2-yl-5-[4-[(E)-2-[4-(5-phenyl-1,3-oxazol-2-yl)phenyl]ethenyl]phenyl]-1,3,4-oxadiazole |
| SMILES | C(=C/c1ccc(-c2nnc(-c3ccc4ccccc4c3)o2)cc1)\c1ccc(-c2ncc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C35H23N3O2/c1-2-7-27(8-3-1)32-23-36-33(39-32)28-16-12-24(13-17-28)10-11-25-14-18-29(19-15-25)34-37-38-35(40-34)31-21-20-26-6-4-5-9-30(26)22-31/h1-23H/b11-10+ |
| InChIKey | CQEFGYWHPPCLQH-ZHACJKMWSA-N |
| XLogP | 9.05 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|