About 3-benzyl-4,8-dimethyl-7-pentoxychromen-2-one
3-benzyl-4,8-dimethyl-7-pentoxychromen-2-one (PubChem CID 22310303) has the molecular formula C23H26O3
and a molecular weight of 350.46 g/mol. Its IUPAC name is 3-benzyl-4,8-dimethyl-7-pentoxychromen-2-one.
Molecular Properties
| Compound Name | 3-benzyl-4,8-dimethyl-7-pentoxychromen-2-one |
| PubChem CID | 22310303 |
| Molecular Formula | C23H26O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 3-benzyl-4,8-dimethyl-7-pentoxychromen-2-one |
| SMILES | CCCCCOc1ccc2c(C)c(Cc3ccccc3)c(=O)oc2c1C |
| InChI | InChI=1S/C23H26O3/c1-4-5-9-14-25-21-13-12-19-16(2)20(15-18-10-7-6-8-11-18)23(24)26-22(19)17(21)3/h6-8,10-13H,4-5,9,14-15H2,1-3H3 |
| InChIKey | XIQRGZNXMGSESY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-4,8-dimethyl-7-pentoxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-4,8-dimethyl-7-pentoxychromen-2-one?
The IUPAC name of 3-benzyl-4,8-dimethyl-7-pentoxychromen-2-one (CID 22310303) is 3-benzyl-4,8-dimethyl-7-pentoxychromen-2-one.
What is the SMILES notation for 3-benzyl-4,8-dimethyl-7-pentoxychromen-2-one?
The canonical SMILES for 3-benzyl-4,8-dimethyl-7-pentoxychromen-2-one is CCCCCOc1ccc2c(C)c(Cc3ccccc3)c(=O)oc2c1C.
What is the InChIKey of 3-benzyl-4,8-dimethyl-7-pentoxychromen-2-one?
The InChIKey is XIQRGZNXMGSESY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26O3/c1-4-5-9-14-25-21-13-12-19-16(2)20(15-18-10-7-6-8-11-18)23(24)26-22(19)17(21)3/h6-8,10-13H,4-5,9,14-15H2,1-3H3.
What are the key properties of 3-benzyl-4,8-dimethyl-7-pentoxychromen-2-one?
3-benzyl-4,8-dimethyl-7-pentoxychromen-2-one has a molecular weight of 350.46 g/mol, XLogP of 5.57, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-4,8-dimethyl-7-pentoxychromen-2-one is sourced from PubChem (CID 22310303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).