C16H12Cl2N2O2 — CID 22310883
4-amino-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylic acid (PubChem CID 22310883) has the molecular formula C16H12Cl2N2O2 and a molecular weight of 335.19 g/mol. Its IUPAC name is 4-amino-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylic acid.
| Compound Name | 4-amino-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 22310883 |
| Molecular Formula | C16H12Cl2N2O2 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 4-amino-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylic acid |
| SMILES | Nc1cccc2c1cc(C(=O)O)n2Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2N2O2/c17-11-5-4-9(6-12(11)18)8-20-14-3-1-2-13(19)10(14)7-15(20)16(21)22/h1-7H,8,19H2,(H,21,22) |
| InChIKey | XDWPMAKSOJITSN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|