About 5-chloro-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylic acid
5-chloro-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylic acid (PubChem CID 22310954) has the molecular formula C16H10Cl3NO2
and a molecular weight of 354.62 g/mol. Its IUPAC name is 5-chloro-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-chloro-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylic acid |
| PubChem CID | 22310954 |
| Molecular Formula | C16H10Cl3NO2 |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | 5-chloro-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(Cl)ccc2n1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H10Cl3NO2/c17-11-2-4-14-10(6-11)7-15(16(21)22)20(14)8-9-1-3-12(18)13(19)5-9/h1-7H,8H2,(H,21,22) |
| InChIKey | ASHZLURJHGQWMH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylic acid?
The IUPAC name of 5-chloro-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylic acid (CID 22310954) is 5-chloro-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylic acid.
What is the SMILES notation for 5-chloro-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylic acid?
The canonical SMILES for 5-chloro-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylic acid is O=C(O)c1cc2cc(Cl)ccc2n1Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 5-chloro-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylic acid?
The InChIKey is ASHZLURJHGQWMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Cl3NO2/c17-11-2-4-14-10(6-11)7-15(16(21)22)20(14)8-9-1-3-12(18)13(19)5-9/h1-7H,8H2,(H,21,22).
What are the key properties of 5-chloro-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylic acid?
5-chloro-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylic acid has a molecular weight of 354.62 g/mol, XLogP of 5.35, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylic acid is sourced from PubChem (CID 22310954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).