About ethyl 4-bromo-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylate
ethyl 4-bromo-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylate (PubChem CID 22311024) has the molecular formula C18H14BrCl2NO2
and a molecular weight of 427.13 g/mol. Its IUPAC name is ethyl 4-bromo-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-bromo-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylate |
| PubChem CID | 22311024 |
| Molecular Formula | C18H14BrCl2NO2 |
| Molecular Weight | 427.13 g/mol |
| Exact Mass | 424.96 |
| IUPAC Name | ethyl 4-bromo-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(Br)cccc2n1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H14BrCl2NO2/c1-2-24-18(23)17-9-12-13(19)4-3-5-16(12)22(17)10-11-6-7-14(20)15(21)8-11/h3-9H,2,10H2,1H3 |
| InChIKey | BEHNTSVSQMORFR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.13 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4-bromo-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-bromo-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylate?
The IUPAC name of ethyl 4-bromo-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylate (CID 22311024) is ethyl 4-bromo-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylate.
What is the SMILES notation for ethyl 4-bromo-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylate?
The canonical SMILES for ethyl 4-bromo-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylate is CCOC(=O)c1cc2c(Br)cccc2n1Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of ethyl 4-bromo-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylate?
The InChIKey is BEHNTSVSQMORFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14BrCl2NO2/c1-2-24-18(23)17-9-12-13(19)4-3-5-16(12)22(17)10-11-6-7-14(20)15(21)8-11/h3-9H,2,10H2,1H3.
What are the key properties of ethyl 4-bromo-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylate?
ethyl 4-bromo-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylate has a molecular weight of 427.13 g/mol, XLogP of 5.94, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-bromo-1-[(3,4-dichlorophenyl)methyl]indole-2-carboxylate is sourced from PubChem (CID 22311024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).