About 2-fluoro-21,22-dihydroporphyrin
2-fluoro-21,22-dihydroporphyrin (PubChem CID 22311550) has the molecular formula C20H13FN4
and a molecular weight of 328.35 g/mol. Its IUPAC name is 2-fluoro-21,22-dihydroporphyrin.
Molecular Properties
| Compound Name | 2-fluoro-21,22-dihydroporphyrin |
| PubChem CID | 22311550 |
| Molecular Formula | C20H13FN4 |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-fluoro-21,22-dihydroporphyrin |
| SMILES | Fc1cc2cc3ccc(cc4nc(cc5nc(cc1[nH]2)C=C5)C=C4)[nH]3 |
| InChI | InChI=1S/C20H13FN4/c21-19-10-18-9-16-4-3-14(23-16)7-12-1-2-13(22-12)8-15-5-6-17(24-15)11-20(19)25-18/h1-11,23,25H/b12-7-,13-8-,14-7-,15-8-,16-9-,17-11-,18-9-,20-11- |
| InChIKey | JXZUHZJAHRZEJK-ZFGIDIDVSA-N |
| XLogP | 4.79 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluoro-21,22-dihydroporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-21,22-dihydroporphyrin?
The IUPAC name of 2-fluoro-21,22-dihydroporphyrin (CID 22311550) is 2-fluoro-21,22-dihydroporphyrin.
What is the SMILES notation for 2-fluoro-21,22-dihydroporphyrin?
The canonical SMILES for 2-fluoro-21,22-dihydroporphyrin is Fc1cc2cc3ccc(cc4nc(cc5nc(cc1[nH]2)C=C5)C=C4)[nH]3.
What is the InChIKey of 2-fluoro-21,22-dihydroporphyrin?
The InChIKey is JXZUHZJAHRZEJK-ZFGIDIDVSA-N. The full InChI is InChI=1S/C20H13FN4/c21-19-10-18-9-16-4-3-14(23-16)7-12-1-2-13(22-12)8-15-5-6-17(24-15)11-20(19)25-18/h1-11,23,25H/b12-7-,13-8-,14-7-,15-8-,16-9-,17-11-,18-9-,20-11-.
What are the key properties of 2-fluoro-21,22-dihydroporphyrin?
2-fluoro-21,22-dihydroporphyrin has a molecular weight of 328.35 g/mol, XLogP of 4.79, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-21,22-dihydroporphyrin is sourced from PubChem (CID 22311550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).