C18H26O — CID 22311768
1-(1,1,3,4,4,6-hexamethyl-2,3-dihydronaphthalen-2-yl)ethanone (PubChem CID 22311768) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is 1-(1,1,3,4,4,6-hexamethyl-2,3-dihydronaphthalen-2-yl)ethanone.
| Compound Name | 1-(1,1,3,4,4,6-hexamethyl-2,3-dihydronaphthalen-2-yl)ethanone |
|---|---|
| PubChem CID | 22311768 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 1-(1,1,3,4,4,6-hexamethyl-2,3-dihydronaphthalen-2-yl)ethanone |
| SMILES | CC(=O)C1C(C)C(C)(C)c2cc(C)ccc2C1(C)C |
| InChI | InChI=1S/C18H26O/c1-11-8-9-14-15(10-11)17(4,5)12(2)16(13(3)19)18(14,6)7/h8-10,12,16H,1-7H3 |
| InChIKey | NFHFVSBMGRCMMB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |