About 2,3-dihydro-1H-inden-1-yl 2-methyl-5-(2-piperidin-1-ylethyl)-1H-indole-3-carboxylate
2,3-dihydro-1H-inden-1-yl 2-methyl-5-(2-piperidin-1-ylethyl)-1H-indole-3-carboxylate (PubChem CID 22311878) has the molecular formula C26H30N2O2
and a molecular weight of 402.54 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-1-yl 2-methyl-5-(2-piperidin-1-ylethyl)-1H-indole-3-carboxylate.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-inden-1-yl 2-methyl-5-(2-piperidin-1-ylethyl)-1H-indole-3-carboxylate |
| PubChem CID | 22311878 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 2,3-dihydro-1H-inden-1-yl 2-methyl-5-(2-piperidin-1-ylethyl)-1H-indole-3-carboxylate |
| SMILES | Cc1[nH]c2ccc(CCN3CCCCC3)cc2c1C(=O)OC1CCc2ccccc21 |
| InChI | InChI=1S/C26H30N2O2/c1-18-25(26(29)30-24-12-10-20-7-3-4-8-21(20)24)22-17-19(9-11-23(22)27-18)13-16-28-14-5-2-6-15-28/h3-4,7-9,11,17,24,27H,2,5-6,10,12-16H2,1H3 |
| InChIKey | YQGJFRIOFLZPCN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydro-1H-inden-1-yl 2-methyl-5-(2-piperidin-1-ylethyl)-1H-indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-inden-1-yl 2-methyl-5-(2-piperidin-1-ylethyl)-1H-indole-3-carboxylate?
The IUPAC name of 2,3-dihydro-1H-inden-1-yl 2-methyl-5-(2-piperidin-1-ylethyl)-1H-indole-3-carboxylate (CID 22311878) is 2,3-dihydro-1H-inden-1-yl 2-methyl-5-(2-piperidin-1-ylethyl)-1H-indole-3-carboxylate.
What is the SMILES notation for 2,3-dihydro-1H-inden-1-yl 2-methyl-5-(2-piperidin-1-ylethyl)-1H-indole-3-carboxylate?
The canonical SMILES for 2,3-dihydro-1H-inden-1-yl 2-methyl-5-(2-piperidin-1-ylethyl)-1H-indole-3-carboxylate is Cc1[nH]c2ccc(CCN3CCCCC3)cc2c1C(=O)OC1CCc2ccccc21.
What is the InChIKey of 2,3-dihydro-1H-inden-1-yl 2-methyl-5-(2-piperidin-1-ylethyl)-1H-indole-3-carboxylate?
The InChIKey is YQGJFRIOFLZPCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30N2O2/c1-18-25(26(29)30-24-12-10-20-7-3-4-8-21(20)24)22-17-19(9-11-23(22)27-18)13-16-28-14-5-2-6-15-28/h3-4,7-9,11,17,24,27H,2,5-6,10,12-16H2,1H3.
What are the key properties of 2,3-dihydro-1H-inden-1-yl 2-methyl-5-(2-piperidin-1-ylethyl)-1H-indole-3-carboxylate?
2,3-dihydro-1H-inden-1-yl 2-methyl-5-(2-piperidin-1-ylethyl)-1H-indole-3-carboxylate has a molecular weight of 402.54 g/mol, XLogP of 5.35, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-inden-1-yl 2-methyl-5-(2-piperidin-1-ylethyl)-1H-indole-3-carboxylate is sourced from PubChem (CID 22311878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).