C10H12N2O — CID 22312263
5-amino-1,2,3,5-tetrahydro-3-benzazepin-4-one (PubChem CID 22312263) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 5-amino-1,2,3,5-tetrahydro-3-benzazepin-4-one.
| Compound Name | 5-amino-1,2,3,5-tetrahydro-3-benzazepin-4-one |
|---|---|
| PubChem CID | 22312263 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 5-amino-1,2,3,5-tetrahydro-3-benzazepin-4-one |
| SMILES | NC1C(=O)NCCc2ccccc21 |
| InChI | InChI=1S/C10H12N2O/c11-9-8-4-2-1-3-7(8)5-6-12-10(9)13/h1-4,9H,5-6,11H2,(H,12,13) |
| InChIKey | QWJOGPWJTLUXTM-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |