About 5-amino-3,3-dimethyl-5,7-dihydro-4H-1-benzazepin-6-one
5-amino-3,3-dimethyl-5,7-dihydro-4H-1-benzazepin-6-one (PubChem CID 22312833) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 5-amino-3,3-dimethyl-5,7-dihydro-4H-1-benzazepin-6-one.
Molecular Properties
| Compound Name | 5-amino-3,3-dimethyl-5,7-dihydro-4H-1-benzazepin-6-one |
| PubChem CID | 22312833 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 5-amino-3,3-dimethyl-5,7-dihydro-4H-1-benzazepin-6-one |
| SMILES | CC1(C)C=NC2=C(C(=O)CC=C2)C(N)C1 |
| InChI | InChI=1S/C12H16N2O/c1-12(2)6-8(13)11-9(14-7-12)4-3-5-10(11)15/h3-4,7-8H,5-6,13H2,1-2H3 |
| InChIKey | JJGDOJADUKYLOT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-amino-3,3-dimethyl-5,7-dihydro-4H-1-benzazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3,3-dimethyl-5,7-dihydro-4H-1-benzazepin-6-one?
The IUPAC name of 5-amino-3,3-dimethyl-5,7-dihydro-4H-1-benzazepin-6-one (CID 22312833) is 5-amino-3,3-dimethyl-5,7-dihydro-4H-1-benzazepin-6-one.
What is the SMILES notation for 5-amino-3,3-dimethyl-5,7-dihydro-4H-1-benzazepin-6-one?
The canonical SMILES for 5-amino-3,3-dimethyl-5,7-dihydro-4H-1-benzazepin-6-one is CC1(C)C=NC2=C(C(=O)CC=C2)C(N)C1.
What is the InChIKey of 5-amino-3,3-dimethyl-5,7-dihydro-4H-1-benzazepin-6-one?
The InChIKey is JJGDOJADUKYLOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O/c1-12(2)6-8(13)11-9(14-7-12)4-3-5-10(11)15/h3-4,7-8H,5-6,13H2,1-2H3.
What are the key properties of 5-amino-3,3-dimethyl-5,7-dihydro-4H-1-benzazepin-6-one?
5-amino-3,3-dimethyl-5,7-dihydro-4H-1-benzazepin-6-one has a molecular weight of 204.27 g/mol, XLogP of 1.60, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3,3-dimethyl-5,7-dihydro-4H-1-benzazepin-6-one is sourced from PubChem (CID 22312833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).