C21H18Cl2N4O4 — CID 22312902
2-[2-chloro-4-[4-(2-methoxyethoxymethyl)-3,5-dioxo-1,2,4-triazin-2-yl]phenyl]-2-(4-chlorophenyl)acetonitrile (PubChem CID 22312902) has the molecular formula C21H18Cl2N4O4 and a molecular weight of 461.31 g/mol. Its IUPAC name is 2-[2-chloro-4-[4-(2-methoxyethoxymethyl)-3,5-dioxo-1,2,4-triazin-2-yl]phenyl]-2-(4-chlorophenyl)acetonitrile.
| Compound Name | 2-[2-chloro-4-[4-(2-methoxyethoxymethyl)-3,5-dioxo-1,2,4-triazin-2-yl]phenyl]-2-(4-chlorophenyl)acetonitrile |
|---|---|
| PubChem CID | 22312902 |
| Molecular Formula | C21H18Cl2N4O4 |
| Molecular Weight | 461.31 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 2-[2-chloro-4-[4-(2-methoxyethoxymethyl)-3,5-dioxo-1,2,4-triazin-2-yl]phenyl]-2-(4-chlorophenyl)acetonitrile |
| SMILES | COCCOCn1c(=O)cnn(-c2ccc(C(C#N)c3ccc(Cl)cc3)c(Cl)c2)c1=O |
| InChI | InChI=1S/C21H18Cl2N4O4/c1-30-8-9-31-13-26-20(28)12-25-27(21(26)29)16-6-7-17(19(23)10-16)18(11-24)14-2-4-15(22)5-3-14/h2-7,10,12,18H,8-9,13H2,1H3 |
| InChIKey | KICCBLDJPSJKIB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 99.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|