C23H27BrN4 — CID 22313176
10-(4-bromo-2,6-dimethylphenyl)-7,11-dimethyl-3-pentan-3-yl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene (PubChem CID 22313176) has the molecular formula C23H27BrN4 and a molecular weight of 439.40 g/mol. Its IUPAC name is 10-(4-bromo-2,6-dimethylphenyl)-7,11-dimethyl-3-pentan-3-yl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene.
| Compound Name | 10-(4-bromo-2,6-dimethylphenyl)-7,11-dimethyl-3-pentan-3-yl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
|---|---|
| PubChem CID | 22313176 |
| Molecular Formula | C23H27BrN4 |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 10-(4-bromo-2,6-dimethylphenyl)-7,11-dimethyl-3-pentan-3-yl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
| SMILES | CCC(CC)n1ccc2c(C)nc3c(-c4c(C)cc(Br)cc4C)c(C)nn3c21 |
| InChI | InChI=1S/C23H27BrN4/c1-7-18(8-2)27-10-9-19-15(5)25-22-21(16(6)26-28(22)23(19)27)20-13(3)11-17(24)12-14(20)4/h9-12,18H,7-8H2,1-6H3 |
| InChIKey | AGRRDPMNWSMFHP-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |