C28H28N4O2 — CID 22313225
3-(3H-1,2-benzodioxol-5-ylmethyl)-4,7,11-trimethyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene (PubChem CID 22313225) has the molecular formula C28H28N4O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is 3-(3H-1,2-benzodioxol-5-ylmethyl)-4,7,11-trimethyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene.
| Compound Name | 3-(3H-1,2-benzodioxol-5-ylmethyl)-4,7,11-trimethyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
|---|---|
| PubChem CID | 22313225 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 3-(3H-1,2-benzodioxol-5-ylmethyl)-4,7,11-trimethyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
| SMILES | Cc1cc(C)c(-c2c(C)nn3c2nc(C)c2cc(C)n(Cc4ccc5c(c4)COO5)c23)c(C)c1 |
| InChI | InChI=1S/C28H28N4O2/c1-15-9-16(2)25(17(3)10-15)26-20(6)30-32-27(26)29-19(5)23-11-18(4)31(28(23)32)13-21-7-8-24-22(12-21)14-33-34-24/h7-12H,13-14H2,1-6H3 |
| InChIKey | NMECEVVDWXMUJR-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 53.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|