About 2-chloro-N-pentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine
2-chloro-N-pentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 22313248) has the molecular formula C12H18ClN3
and a molecular weight of 239.75 g/mol. Its IUPAC name is 2-chloro-N-pentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-chloro-N-pentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
| PubChem CID | 22313248 |
| Molecular Formula | C12H18ClN3 |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 2-chloro-N-pentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | CCCCCNc1nc(Cl)nc2c1CCC2 |
| InChI | InChI=1S/C12H18ClN3/c1-2-3-4-8-14-11-9-6-5-7-10(9)15-12(13)16-11/h2-8H2,1H3,(H,14,15,16) |
| InChIKey | DKQJLZGVCBMQGR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-pentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-pentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
The IUPAC name of 2-chloro-N-pentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine (CID 22313248) is 2-chloro-N-pentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine.
What is the SMILES notation for 2-chloro-N-pentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
The canonical SMILES for 2-chloro-N-pentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine is CCCCCNc1nc(Cl)nc2c1CCC2.
What is the InChIKey of 2-chloro-N-pentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
The InChIKey is DKQJLZGVCBMQGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClN3/c1-2-3-4-8-14-11-9-6-5-7-10(9)15-12(13)16-11/h2-8H2,1H3,(H,14,15,16).
What are the key properties of 2-chloro-N-pentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
2-chloro-N-pentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine has a molecular weight of 239.75 g/mol, XLogP of 3.22, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-pentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine is sourced from PubChem (CID 22313248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).