About 3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylic acid
3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylic acid (PubChem CID 22313360) has the molecular formula C9H9NO3
and a molecular weight of 179.18 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylic acid.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylic acid |
| PubChem CID | 22313360 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylic acid |
| SMILES | O=C(O)c1cc2c(cn1)OCCC2 |
| InChI | InChI=1S/C9H9NO3/c11-9(12)7-4-6-2-1-3-13-8(6)5-10-7/h4-5H,1-3H2,(H,11,12) |
| InChIKey | AEBMIGWPSNFWOA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylic acid?
The IUPAC name of 3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylic acid (CID 22313360) is 3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylic acid.
What is the SMILES notation for 3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylic acid?
The canonical SMILES for 3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylic acid is O=C(O)c1cc2c(cn1)OCCC2.
What is the InChIKey of 3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylic acid?
The InChIKey is AEBMIGWPSNFWOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3/c11-9(12)7-4-6-2-1-3-13-8(6)5-10-7/h4-5H,1-3H2,(H,11,12).
What are the key properties of 3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylic acid?
3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylic acid has a molecular weight of 179.18 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-pyrano[2,3-c]pyridine-6-carboxylic acid is sourced from PubChem (CID 22313360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).