About 3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-ylmethanol
3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-ylmethanol (PubChem CID 22313361) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-ylmethanol.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-ylmethanol |
| PubChem CID | 22313361 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-ylmethanol |
| SMILES | OCc1cc2c(cn1)OCCC2 |
| InChI | InChI=1S/C9H11NO2/c11-6-8-4-7-2-1-3-12-9(7)5-10-8/h4-5,11H,1-3,6H2 |
| InChIKey | QXVCUSYHDODUGS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-ylmethanol?
The IUPAC name of 3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-ylmethanol (CID 22313361) is 3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-ylmethanol.
What is the SMILES notation for 3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-ylmethanol?
The canonical SMILES for 3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-ylmethanol is OCc1cc2c(cn1)OCCC2.
What is the InChIKey of 3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-ylmethanol?
The InChIKey is QXVCUSYHDODUGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c11-6-8-4-7-2-1-3-12-9(7)5-10-8/h4-5,11H,1-3,6H2.
What are the key properties of 3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-ylmethanol?
3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-ylmethanol has a molecular weight of 165.19 g/mol, XLogP of 0.90, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-ylmethanol is sourced from PubChem (CID 22313361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).