C14H14Cl3N3O2 — CID 2231342
2,2,2-trichloro-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-N-propan-2-ylacetamide (PubChem CID 2231342) has the molecular formula C14H14Cl3N3O2 and a molecular weight of 362.64 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-N-propan-2-ylacetamide.
| Compound Name | 2,2,2-trichloro-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 2231342 |
| Molecular Formula | C14H14Cl3N3O2 |
| Molecular Weight | 362.64 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 2,2,2-trichloro-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-N-propan-2-ylacetamide |
| SMILES | CC(C)N(Cc1nc(-c2ccccc2)no1)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H14Cl3N3O2/c1-9(2)20(13(21)14(15,16)17)8-11-18-12(19-22-11)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| InChIKey | QWPLZBDOGLSULZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.64 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|