About 3-(4-chlorophenyl)-7,8-dimethoxy-6-nitrochromen-2-one
3-(4-chlorophenyl)-7,8-dimethoxy-6-nitrochromen-2-one (PubChem CID 22313449) has the molecular formula C17H12ClNO6
and a molecular weight of 361.74 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-7,8-dimethoxy-6-nitrochromen-2-one.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-7,8-dimethoxy-6-nitrochromen-2-one |
| PubChem CID | 22313449 |
| Molecular Formula | C17H12ClNO6 |
| Molecular Weight | 361.74 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 3-(4-chlorophenyl)-7,8-dimethoxy-6-nitrochromen-2-one |
| SMILES | COc1c([N+](=O)[O-])cc2cc(-c3ccc(Cl)cc3)c(=O)oc2c1OC |
| InChI | InChI=1S/C17H12ClNO6/c1-23-15-13(19(21)22)8-10-7-12(9-3-5-11(18)6-4-9)17(20)25-14(10)16(15)24-2/h3-8H,1-2H3 |
| InChIKey | DSMKGOXFBBHSRI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 91.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.74 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chlorophenyl)-7,8-dimethoxy-6-nitrochromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-7,8-dimethoxy-6-nitrochromen-2-one?
The IUPAC name of 3-(4-chlorophenyl)-7,8-dimethoxy-6-nitrochromen-2-one (CID 22313449) is 3-(4-chlorophenyl)-7,8-dimethoxy-6-nitrochromen-2-one.
What is the SMILES notation for 3-(4-chlorophenyl)-7,8-dimethoxy-6-nitrochromen-2-one?
The canonical SMILES for 3-(4-chlorophenyl)-7,8-dimethoxy-6-nitrochromen-2-one is COc1c([N+](=O)[O-])cc2cc(-c3ccc(Cl)cc3)c(=O)oc2c1OC.
What is the InChIKey of 3-(4-chlorophenyl)-7,8-dimethoxy-6-nitrochromen-2-one?
The InChIKey is DSMKGOXFBBHSRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12ClNO6/c1-23-15-13(19(21)22)8-10-7-12(9-3-5-11(18)6-4-9)17(20)25-14(10)16(15)24-2/h3-8H,1-2H3.
What are the key properties of 3-(4-chlorophenyl)-7,8-dimethoxy-6-nitrochromen-2-one?
3-(4-chlorophenyl)-7,8-dimethoxy-6-nitrochromen-2-one has a molecular weight of 361.74 g/mol, XLogP of 4.04, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-7,8-dimethoxy-6-nitrochromen-2-one is sourced from PubChem (CID 22313449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).