C17H12Cl2N2O5S — CID 22313854
2-amino-5-[(5,6-dichloro-1,3-dioxoisoindol-2-yl)methyl]-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylic acid (PubChem CID 22313854) has the molecular formula C17H12Cl2N2O5S and a molecular weight of 427.27 g/mol. Its IUPAC name is 2-amino-5-[(5,6-dichloro-1,3-dioxoisoindol-2-yl)methyl]-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylic acid.
| Compound Name | 2-amino-5-[(5,6-dichloro-1,3-dioxoisoindol-2-yl)methyl]-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylic acid |
|---|---|
| PubChem CID | 22313854 |
| Molecular Formula | C17H12Cl2N2O5S |
| Molecular Weight | 427.27 g/mol |
| Exact Mass | 425.98 |
| IUPAC Name | 2-amino-5-[(5,6-dichloro-1,3-dioxoisoindol-2-yl)methyl]-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylic acid |
| SMILES | Nc1sc2c(c1C(=O)O)CC(CN1C(=O)c3cc(Cl)c(Cl)cc3C1=O)OC2 |
| InChI | InChI=1S/C17H12Cl2N2O5S/c18-10-2-7-8(3-11(10)19)16(23)21(15(7)22)4-6-1-9-12(5-26-6)27-14(20)13(9)17(24)25/h2-3,6H,1,4-5,20H2,(H,24,25) |
| InChIKey | UICGYLWPGAAWMQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|