About 9H-thieno[2,3-c]chromene
9H-thieno[2,3-c]chromene (PubChem CID 22313871) has the molecular formula C11H8OS
and a molecular weight of 188.25 g/mol. Its IUPAC name is 9H-thieno[2,3-c]chromene.
Molecular Properties
| Compound Name | 9H-thieno[2,3-c]chromene |
| PubChem CID | 22313871 |
| Molecular Formula | C11H8OS |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 9H-thieno[2,3-c]chromene |
| SMILES | C1=CCC2=c3ccsc3=COC2=C1 |
| InChI | InChI=1S/C11H8OS/c1-2-4-10-8(3-1)9-5-6-13-11(9)7-12-10/h1-2,4-7H,3H2 |
| InChIKey | KCJMVMOWVXHGMR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9H-thieno[2,3-c]chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-thieno[2,3-c]chromene?
The IUPAC name of 9H-thieno[2,3-c]chromene (CID 22313871) is 9H-thieno[2,3-c]chromene.
What is the SMILES notation for 9H-thieno[2,3-c]chromene?
The canonical SMILES for 9H-thieno[2,3-c]chromene is C1=CCC2=c3ccsc3=COC2=C1.
What is the InChIKey of 9H-thieno[2,3-c]chromene?
The InChIKey is KCJMVMOWVXHGMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8OS/c1-2-4-10-8(3-1)9-5-6-13-11(9)7-12-10/h1-2,4-7H,3H2.
What are the key properties of 9H-thieno[2,3-c]chromene?
9H-thieno[2,3-c]chromene has a molecular weight of 188.25 g/mol, XLogP of 1.51, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-thieno[2,3-c]chromene is sourced from PubChem (CID 22313871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).