About 6-[4-(azetidin-1-yl)butoxy]-3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazole
6-[4-(azetidin-1-yl)butoxy]-3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazole (PubChem CID 22313966) has the molecular formula C21H21F3N2OS
and a molecular weight of 406.47 g/mol. Its IUPAC name is 6-[4-(azetidin-1-yl)butoxy]-3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazole.
Molecular Properties
| Compound Name | 6-[4-(azetidin-1-yl)butoxy]-3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazole |
| PubChem CID | 22313966 |
| Molecular Formula | C21H21F3N2OS |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 6-[4-(azetidin-1-yl)butoxy]-3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazole |
| SMILES | FC(F)(F)c1ccc(-c2nsc3cc(OCCCCN4CCC4)ccc23)cc1 |
| InChI | InChI=1S/C21H21F3N2OS/c22-21(23,24)16-6-4-15(5-7-16)20-18-9-8-17(14-19(18)28-25-20)27-13-2-1-10-26-11-3-12-26/h4-9,14H,1-3,10-13H2 |
| InChIKey | MORVGHKRLHHCOL-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-(azetidin-1-yl)butoxy]-3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(azetidin-1-yl)butoxy]-3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazole?
The IUPAC name of 6-[4-(azetidin-1-yl)butoxy]-3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazole (CID 22313966) is 6-[4-(azetidin-1-yl)butoxy]-3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazole.
What is the SMILES notation for 6-[4-(azetidin-1-yl)butoxy]-3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazole?
The canonical SMILES for 6-[4-(azetidin-1-yl)butoxy]-3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazole is FC(F)(F)c1ccc(-c2nsc3cc(OCCCCN4CCC4)ccc23)cc1.
What is the InChIKey of 6-[4-(azetidin-1-yl)butoxy]-3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazole?
The InChIKey is MORVGHKRLHHCOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21F3N2OS/c22-21(23,24)16-6-4-15(5-7-16)20-18-9-8-17(14-19(18)28-25-20)27-13-2-1-10-26-11-3-12-26/h4-9,14H,1-3,10-13H2.
What are the key properties of 6-[4-(azetidin-1-yl)butoxy]-3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazole?
6-[4-(azetidin-1-yl)butoxy]-3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazole has a molecular weight of 406.47 g/mol, XLogP of 5.85, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(azetidin-1-yl)butoxy]-3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazole is sourced from PubChem (CID 22313966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).