About 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N,N-diethylbutan-1-amine
4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N,N-diethylbutan-1-amine (PubChem CID 22313971) has the molecular formula C21H25ClN2OS
and a molecular weight of 388.96 g/mol. Its IUPAC name is 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N,N-diethylbutan-1-amine.
Molecular Properties
| Compound Name | 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N,N-diethylbutan-1-amine |
| PubChem CID | 22313971 |
| Molecular Formula | C21H25ClN2OS |
| Molecular Weight | 388.96 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N,N-diethylbutan-1-amine |
| SMILES | CCN(CC)CCCCOc1ccc2c(-c3ccc(Cl)cc3)nsc2c1 |
| InChI | InChI=1S/C21H25ClN2OS/c1-3-24(4-2)13-5-6-14-25-18-11-12-19-20(15-18)26-23-21(19)16-7-9-17(22)10-8-16/h7-12,15H,3-6,13-14H2,1-2H3 |
| InChIKey | IPPOEZDHIPCFQL-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.96 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N,N-diethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N,N-diethylbutan-1-amine?
The IUPAC name of 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N,N-diethylbutan-1-amine (CID 22313971) is 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N,N-diethylbutan-1-amine.
What is the SMILES notation for 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N,N-diethylbutan-1-amine?
The canonical SMILES for 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N,N-diethylbutan-1-amine is CCN(CC)CCCCOc1ccc2c(-c3ccc(Cl)cc3)nsc2c1.
What is the InChIKey of 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N,N-diethylbutan-1-amine?
The InChIKey is IPPOEZDHIPCFQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25ClN2OS/c1-3-24(4-2)13-5-6-14-25-18-11-12-19-20(15-18)26-23-21(19)16-7-9-17(22)10-8-16/h7-12,15H,3-6,13-14H2,1-2H3.
What are the key properties of 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N,N-diethylbutan-1-amine?
4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N,N-diethylbutan-1-amine has a molecular weight of 388.96 g/mol, XLogP of 6.12, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N,N-diethylbutan-1-amine is sourced from PubChem (CID 22313971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).