About 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N-ethyl-N-(2-methoxyethyl)butan-1-amine
4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N-ethyl-N-(2-methoxyethyl)butan-1-amine (PubChem CID 22314050) has the molecular formula C22H27ClN2O2S
and a molecular weight of 418.99 g/mol. Its IUPAC name is 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N-ethyl-N-(2-methoxyethyl)butan-1-amine.
Molecular Properties
| Compound Name | 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N-ethyl-N-(2-methoxyethyl)butan-1-amine |
| PubChem CID | 22314050 |
| Molecular Formula | C22H27ClN2O2S |
| Molecular Weight | 418.99 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N-ethyl-N-(2-methoxyethyl)butan-1-amine |
| SMILES | CCN(CCCCOc1ccc2c(-c3ccc(Cl)cc3)nsc2c1)CCOC |
| InChI | InChI=1S/C22H27ClN2O2S/c1-3-25(13-15-26-2)12-4-5-14-27-19-10-11-20-21(16-19)28-24-22(20)17-6-8-18(23)9-7-17/h6-11,16H,3-5,12-15H2,1-2H3 |
| InChIKey | DNISNWALWYLRPK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.99 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N-ethyl-N-(2-methoxyethyl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N-ethyl-N-(2-methoxyethyl)butan-1-amine?
The IUPAC name of 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N-ethyl-N-(2-methoxyethyl)butan-1-amine (CID 22314050) is 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N-ethyl-N-(2-methoxyethyl)butan-1-amine.
What is the SMILES notation for 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N-ethyl-N-(2-methoxyethyl)butan-1-amine?
The canonical SMILES for 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N-ethyl-N-(2-methoxyethyl)butan-1-amine is CCN(CCCCOc1ccc2c(-c3ccc(Cl)cc3)nsc2c1)CCOC.
What is the InChIKey of 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N-ethyl-N-(2-methoxyethyl)butan-1-amine?
The InChIKey is DNISNWALWYLRPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27ClN2O2S/c1-3-25(13-15-26-2)12-4-5-14-27-19-10-11-20-21(16-19)28-24-22(20)17-6-8-18(23)9-7-17/h6-11,16H,3-5,12-15H2,1-2H3.
What are the key properties of 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N-ethyl-N-(2-methoxyethyl)butan-1-amine?
4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N-ethyl-N-(2-methoxyethyl)butan-1-amine has a molecular weight of 418.99 g/mol, XLogP of 5.74, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-(4-chlorophenyl)-1,2-benzothiazol-6-yl]oxy]-N-ethyl-N-(2-methoxyethyl)butan-1-amine is sourced from PubChem (CID 22314050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).