About 2-[(Z)-1-[5-chloro-2-(3,4-dichlorophenyl)-1-methylindol-3-yl]ethylideneamino]guanidine
2-[(Z)-1-[5-chloro-2-(3,4-dichlorophenyl)-1-methylindol-3-yl]ethylideneamino]guanidine (PubChem CID 22314326) has the molecular formula C18H16Cl3N5
and a molecular weight of 408.72 g/mol. Its IUPAC name is 2-[(Z)-1-[5-chloro-2-(3,4-dichlorophenyl)-1-methylindol-3-yl]ethylideneamino]guanidine.
Molecular Properties
| Compound Name | 2-[(Z)-1-[5-chloro-2-(3,4-dichlorophenyl)-1-methylindol-3-yl]ethylideneamino]guanidine |
| PubChem CID | 22314326 |
| Molecular Formula | C18H16Cl3N5 |
| Molecular Weight | 408.72 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 2-[(Z)-1-[5-chloro-2-(3,4-dichlorophenyl)-1-methylindol-3-yl]ethylideneamino]guanidine |
| SMILES | C/C(=N/N=C(N)N)c1c(-c2ccc(Cl)c(Cl)c2)n(C)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C18H16Cl3N5/c1-9(24-25-18(22)23)16-12-8-11(19)4-6-15(12)26(2)17(16)10-3-5-13(20)14(21)7-10/h3-8H,1-2H3,(H4,22,23,25)/b24-9- |
| InChIKey | CIXSZSFOJHKUMA-OPVMPGTRSA-N |
| XLogP | 4.80 |
| TPSA | 81.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.72 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(Z)-1-[5-chloro-2-(3,4-dichlorophenyl)-1-methylindol-3-yl]ethylideneamino]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-1-[5-chloro-2-(3,4-dichlorophenyl)-1-methylindol-3-yl]ethylideneamino]guanidine?
The IUPAC name of 2-[(Z)-1-[5-chloro-2-(3,4-dichlorophenyl)-1-methylindol-3-yl]ethylideneamino]guanidine (CID 22314326) is 2-[(Z)-1-[5-chloro-2-(3,4-dichlorophenyl)-1-methylindol-3-yl]ethylideneamino]guanidine.
What is the SMILES notation for 2-[(Z)-1-[5-chloro-2-(3,4-dichlorophenyl)-1-methylindol-3-yl]ethylideneamino]guanidine?
The canonical SMILES for 2-[(Z)-1-[5-chloro-2-(3,4-dichlorophenyl)-1-methylindol-3-yl]ethylideneamino]guanidine is C/C(=N/N=C(N)N)c1c(-c2ccc(Cl)c(Cl)c2)n(C)c2ccc(Cl)cc12.
What is the InChIKey of 2-[(Z)-1-[5-chloro-2-(3,4-dichlorophenyl)-1-methylindol-3-yl]ethylideneamino]guanidine?
The InChIKey is CIXSZSFOJHKUMA-OPVMPGTRSA-N. The full InChI is InChI=1S/C18H16Cl3N5/c1-9(24-25-18(22)23)16-12-8-11(19)4-6-15(12)26(2)17(16)10-3-5-13(20)14(21)7-10/h3-8H,1-2H3,(H4,22,23,25)/b24-9-.
What are the key properties of 2-[(Z)-1-[5-chloro-2-(3,4-dichlorophenyl)-1-methylindol-3-yl]ethylideneamino]guanidine?
2-[(Z)-1-[5-chloro-2-(3,4-dichlorophenyl)-1-methylindol-3-yl]ethylideneamino]guanidine has a molecular weight of 408.72 g/mol, XLogP of 4.80, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-1-[5-chloro-2-(3,4-dichlorophenyl)-1-methylindol-3-yl]ethylideneamino]guanidine is sourced from PubChem (CID 22314326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).