About (Z)-2-amino-7-(1-aminoethylideneamino)-2,5-dimethylhept-5-enoic acid
(Z)-2-amino-7-(1-aminoethylideneamino)-2,5-dimethylhept-5-enoic acid (PubChem CID 22314562) has the molecular formula C11H21N3O2
and a molecular weight of 227.31 g/mol. Its IUPAC name is (Z)-2-amino-7-(1-aminoethylideneamino)-2,5-dimethylhept-5-enoic acid.
Molecular Properties
| Compound Name | (Z)-2-amino-7-(1-aminoethylideneamino)-2,5-dimethylhept-5-enoic acid |
| PubChem CID | 22314562 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | (Z)-2-amino-7-(1-aminoethylideneamino)-2,5-dimethylhept-5-enoic acid |
| SMILES | C/C(=C/C/N=C(\C)N)CCC(C)(N)C(=O)O |
| InChI | InChI=1S/C11H21N3O2/c1-8(5-7-14-9(2)12)4-6-11(3,13)10(15)16/h5H,4,6-7,13H2,1-3H3,(H2,12,14)(H,15,16)/b8-5- |
| InChIKey | IZVGAPNDFLQBES-YVMONPNESA-N |
| XLogP | 0.89 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-amino-7-(1-aminoethylideneamino)-2,5-dimethylhept-5-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-amino-7-(1-aminoethylideneamino)-2,5-dimethylhept-5-enoic acid?
The IUPAC name of (Z)-2-amino-7-(1-aminoethylideneamino)-2,5-dimethylhept-5-enoic acid (CID 22314562) is (Z)-2-amino-7-(1-aminoethylideneamino)-2,5-dimethylhept-5-enoic acid.
What is the SMILES notation for (Z)-2-amino-7-(1-aminoethylideneamino)-2,5-dimethylhept-5-enoic acid?
The canonical SMILES for (Z)-2-amino-7-(1-aminoethylideneamino)-2,5-dimethylhept-5-enoic acid is C/C(=C/C/N=C(\C)N)CCC(C)(N)C(=O)O.
What is the InChIKey of (Z)-2-amino-7-(1-aminoethylideneamino)-2,5-dimethylhept-5-enoic acid?
The InChIKey is IZVGAPNDFLQBES-YVMONPNESA-N. The full InChI is InChI=1S/C11H21N3O2/c1-8(5-7-14-9(2)12)4-6-11(3,13)10(15)16/h5H,4,6-7,13H2,1-3H3,(H2,12,14)(H,15,16)/b8-5-.
What are the key properties of (Z)-2-amino-7-(1-aminoethylideneamino)-2,5-dimethylhept-5-enoic acid?
(Z)-2-amino-7-(1-aminoethylideneamino)-2,5-dimethylhept-5-enoic acid has a molecular weight of 227.31 g/mol, XLogP of 0.89, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-amino-7-(1-aminoethylideneamino)-2,5-dimethylhept-5-enoic acid is sourced from PubChem (CID 22314562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).