About 1,5-bis(hydroxymethyl)imidazolidine-2,4-dione
1,5-bis(hydroxymethyl)imidazolidine-2,4-dione (PubChem CID 22314728) has the molecular formula C5H8N2O4
and a molecular weight of 160.13 g/mol. Its IUPAC name is 1,5-bis(hydroxymethyl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 1,5-bis(hydroxymethyl)imidazolidine-2,4-dione |
| PubChem CID | 22314728 |
| Molecular Formula | C5H8N2O4 |
| Molecular Weight | 160.13 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 1,5-bis(hydroxymethyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)N(CO)C1CO |
| InChI | InChI=1S/C5H8N2O4/c8-1-3-4(10)6-5(11)7(3)2-9/h3,8-9H,1-2H2,(H,6,10,11) |
| InChIKey | CHRJGPQWBRVNCO-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.13 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 1,5-bis(hydroxymethyl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-bis(hydroxymethyl)imidazolidine-2,4-dione?
The IUPAC name of 1,5-bis(hydroxymethyl)imidazolidine-2,4-dione (CID 22314728) is 1,5-bis(hydroxymethyl)imidazolidine-2,4-dione.
What is the SMILES notation for 1,5-bis(hydroxymethyl)imidazolidine-2,4-dione?
The canonical SMILES for 1,5-bis(hydroxymethyl)imidazolidine-2,4-dione is O=C1NC(=O)N(CO)C1CO.
What is the InChIKey of 1,5-bis(hydroxymethyl)imidazolidine-2,4-dione?
The InChIKey is CHRJGPQWBRVNCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O4/c8-1-3-4(10)6-5(11)7(3)2-9/h3,8-9H,1-2H2,(H,6,10,11).
What are the key properties of 1,5-bis(hydroxymethyl)imidazolidine-2,4-dione?
1,5-bis(hydroxymethyl)imidazolidine-2,4-dione has a molecular weight of 160.13 g/mol, XLogP of -2.15, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis(hydroxymethyl)imidazolidine-2,4-dione is sourced from PubChem (CID 22314728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).