C27H27N2O3P-2 — CID 22315064
dioxido-oxo-[3-(1-tritylimidazol-4-yl)pentan-3-yl]-λ5-phosphane (PubChem CID 22315064) has the molecular formula C27H27N2O3P-2 and a molecular weight of 458.50 g/mol. Its IUPAC name is dioxido-oxo-[3-(1-tritylimidazol-4-yl)pentan-3-yl]-λ5-phosphane.
| Compound Name | dioxido-oxo-[3-(1-tritylimidazol-4-yl)pentan-3-yl]-λ5-phosphane |
|---|---|
| PubChem CID | 22315064 |
| Molecular Formula | C27H27N2O3P-2 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | dioxido-oxo-[3-(1-tritylimidazol-4-yl)pentan-3-yl]-λ5-phosphane |
| SMILES | CCC(CC)(c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)P(=O)([O-])[O-] |
| InChI | InChI=1S/C27H29N2O3P/c1-3-26(4-2,33(30,31)32)25-20-29(21-28-25)27(22-14-8-5-9-15-22,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h5-21H,3-4H2,1-2H3,(H2,30,31,32)/p-2 |
| InChIKey | VAGFEIFNKKXNGR-UHFFFAOYSA-L |
| XLogP | 4.65 |
| TPSA | 81.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|