About 4-(1H-imidazol-5-ylmethyl)piperidine;dihydrobromide
4-(1H-imidazol-5-ylmethyl)piperidine;dihydrobromide (PubChem CID 22315065) has the molecular formula C9H17Br2N3
and a molecular weight of 327.06 g/mol. Its IUPAC name is 4-(1H-imidazol-5-ylmethyl)piperidine;dihydrobromide.
Molecular Properties
| Compound Name | 4-(1H-imidazol-5-ylmethyl)piperidine;dihydrobromide |
| PubChem CID | 22315065 |
| Molecular Formula | C9H17Br2N3 |
| Molecular Weight | 327.06 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | 4-(1H-imidazol-5-ylmethyl)piperidine;dihydrobromide |
| SMILES | Br.Br.c1ncc(CC2CCNCC2)[nH]1 |
| InChI | InChI=1S/C9H15N3.2BrH/c1-3-10-4-2-8(1)5-9-6-11-7-12-9;;/h6-8,10H,1-5H2,(H,11,12);2*1H |
| InChIKey | YGNJPNRDGXJQJX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.06 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(1H-imidazol-5-ylmethyl)piperidine;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-imidazol-5-ylmethyl)piperidine;dihydrobromide?
The IUPAC name of 4-(1H-imidazol-5-ylmethyl)piperidine;dihydrobromide (CID 22315065) is 4-(1H-imidazol-5-ylmethyl)piperidine;dihydrobromide.
What is the SMILES notation for 4-(1H-imidazol-5-ylmethyl)piperidine;dihydrobromide?
The canonical SMILES for 4-(1H-imidazol-5-ylmethyl)piperidine;dihydrobromide is Br.Br.c1ncc(CC2CCNCC2)[nH]1.
What is the InChIKey of 4-(1H-imidazol-5-ylmethyl)piperidine;dihydrobromide?
The InChIKey is YGNJPNRDGXJQJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3.2BrH/c1-3-10-4-2-8(1)5-9-6-11-7-12-9;;/h6-8,10H,1-5H2,(H,11,12);2*1H.
What are the key properties of 4-(1H-imidazol-5-ylmethyl)piperidine;dihydrobromide?
4-(1H-imidazol-5-ylmethyl)piperidine;dihydrobromide has a molecular weight of 327.06 g/mol, XLogP of 2.11, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-imidazol-5-ylmethyl)piperidine;dihydrobromide is sourced from PubChem (CID 22315065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).