C20H17N5O2S2 — CID 2231564
N-(1,3-benzothiazol-2-yl)-2-[[5-(2-hydroxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 2231564) has the molecular formula C20H17N5O2S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-[[5-(2-hydroxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-[[5-(2-hydroxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 2231564 |
| Molecular Formula | C20H17N5O2S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-[[5-(2-hydroxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2nc3ccccc3s2)nnc1-c1ccccc1O |
| InChI | InChI=1S/C20H17N5O2S2/c1-2-11-25-18(13-7-3-5-9-15(13)26)23-24-20(25)28-12-17(27)22-19-21-14-8-4-6-10-16(14)29-19/h2-10,26H,1,11-12H2,(H,21,22,27) |
| InChIKey | AATANFHXEWNWNX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|