C22H38N2 — CID 22315759
N'-(2-adamantyl)-N-[(2Z)-3,7-dimethylocta-2,6-dienyl]ethane-1,2-diamine (PubChem CID 22315759) has the molecular formula C22H38N2 and a molecular weight of 330.56 g/mol. Its IUPAC name is N'-(2-adamantyl)-N-[(2Z)-3,7-dimethylocta-2,6-dienyl]ethane-1,2-diamine.
| Compound Name | N'-(2-adamantyl)-N-[(2Z)-3,7-dimethylocta-2,6-dienyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 22315759 |
| Molecular Formula | C22H38N2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.30 |
| IUPAC Name | N'-(2-adamantyl)-N-[(2Z)-3,7-dimethylocta-2,6-dienyl]ethane-1,2-diamine |
| SMILES | CC(C)=CCC/C(C)=C\CNCCNC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C22H38N2/c1-16(2)5-4-6-17(3)7-8-23-9-10-24-22-20-12-18-11-19(14-20)15-21(22)13-18/h5,7,18-24H,4,6,8-15H2,1-3H3/b17-7- |
| InChIKey | JFIBVDBTCDTBRH-IDUWFGFVSA-N |
| XLogP | 4.68 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|