About 5-[[2-(3,4-dimethylphenoxy)acetyl]amino]-2-hydroxybenzoic acid
5-[[2-(3,4-dimethylphenoxy)acetyl]amino]-2-hydroxybenzoic acid (PubChem CID 2231577) has the molecular formula C17H17NO5
and a molecular weight of 315.33 g/mol. Its IUPAC name is 5-[[2-(3,4-dimethylphenoxy)acetyl]amino]-2-hydroxybenzoic acid.
Molecular Properties
| Compound Name | 5-[[2-(3,4-dimethylphenoxy)acetyl]amino]-2-hydroxybenzoic acid |
| PubChem CID | 2231577 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 5-[[2-(3,4-dimethylphenoxy)acetyl]amino]-2-hydroxybenzoic acid |
| SMILES | Cc1ccc(OCC(=O)Nc2ccc(O)c(C(=O)O)c2)cc1C |
| InChI | InChI=1S/C17H17NO5/c1-10-3-5-13(7-11(10)2)23-9-16(20)18-12-4-6-15(19)14(8-12)17(21)22/h3-8,19H,9H2,1-2H3,(H,18,20)(H,21,22) |
| InChIKey | UHNAWUPVALFOEF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 5-[[2-(3,4-dimethylphenoxy)acetyl]amino]-2-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[2-(3,4-dimethylphenoxy)acetyl]amino]-2-hydroxybenzoic acid?
The IUPAC name of 5-[[2-(3,4-dimethylphenoxy)acetyl]amino]-2-hydroxybenzoic acid (CID 2231577) is 5-[[2-(3,4-dimethylphenoxy)acetyl]amino]-2-hydroxybenzoic acid.
What is the SMILES notation for 5-[[2-(3,4-dimethylphenoxy)acetyl]amino]-2-hydroxybenzoic acid?
The canonical SMILES for 5-[[2-(3,4-dimethylphenoxy)acetyl]amino]-2-hydroxybenzoic acid is Cc1ccc(OCC(=O)Nc2ccc(O)c(C(=O)O)c2)cc1C.
What is the InChIKey of 5-[[2-(3,4-dimethylphenoxy)acetyl]amino]-2-hydroxybenzoic acid?
The InChIKey is UHNAWUPVALFOEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO5/c1-10-3-5-13(7-11(10)2)23-9-16(20)18-12-4-6-15(19)14(8-12)17(21)22/h3-8,19H,9H2,1-2H3,(H,18,20)(H,21,22).
What are the key properties of 5-[[2-(3,4-dimethylphenoxy)acetyl]amino]-2-hydroxybenzoic acid?
5-[[2-(3,4-dimethylphenoxy)acetyl]amino]-2-hydroxybenzoic acid has a molecular weight of 315.33 g/mol, XLogP of 2.72, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[2-(3,4-dimethylphenoxy)acetyl]amino]-2-hydroxybenzoic acid is sourced from PubChem (CID 2231577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).