About (9,10-dioxoanthracen-2-yl)-diethyl-methylazanium;phosphoric acid
(9,10-dioxoanthracen-2-yl)-diethyl-methylazanium;phosphoric acid (PubChem CID 22315904) has the molecular formula C19H23NO6P+
and a molecular weight of 392.37 g/mol. Its IUPAC name is (9,10-dioxoanthracen-2-yl)-diethyl-methylazanium;phosphoric acid.
Molecular Properties
| Compound Name | (9,10-dioxoanthracen-2-yl)-diethyl-methylazanium;phosphoric acid |
| PubChem CID | 22315904 |
| Molecular Formula | C19H23NO6P+ |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | (9,10-dioxoanthracen-2-yl)-diethyl-methylazanium;phosphoric acid |
| SMILES | CC[N+](C)(CC)c1ccc2c(c1)C(=O)c1ccccc1C2=O.O=P(O)(O)O |
| InChI | InChI=1S/C19H20NO2.H3O4P/c1-4-20(3,5-2)13-10-11-16-17(12-13)19(22)15-9-7-6-8-14(15)18(16)21;1-5(2,3)4/h6-12H,4-5H2,1-3H3;(H3,1,2,3,4)/q+1; |
| InChIKey | DVNVWGABJMEADD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (9,10-dioxoanthracen-2-yl)-diethyl-methylazanium;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9,10-dioxoanthracen-2-yl)-diethyl-methylazanium;phosphoric acid?
The IUPAC name of (9,10-dioxoanthracen-2-yl)-diethyl-methylazanium;phosphoric acid (CID 22315904) is (9,10-dioxoanthracen-2-yl)-diethyl-methylazanium;phosphoric acid.
What is the SMILES notation for (9,10-dioxoanthracen-2-yl)-diethyl-methylazanium;phosphoric acid?
The canonical SMILES for (9,10-dioxoanthracen-2-yl)-diethyl-methylazanium;phosphoric acid is CC[N+](C)(CC)c1ccc2c(c1)C(=O)c1ccccc1C2=O.O=P(O)(O)O.
What is the InChIKey of (9,10-dioxoanthracen-2-yl)-diethyl-methylazanium;phosphoric acid?
The InChIKey is DVNVWGABJMEADD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20NO2.H3O4P/c1-4-20(3,5-2)13-10-11-16-17(12-13)19(22)15-9-7-6-8-14(15)18(16)21;1-5(2,3)4/h6-12H,4-5H2,1-3H3;(H3,1,2,3,4)/q+1;.
What are the key properties of (9,10-dioxoanthracen-2-yl)-diethyl-methylazanium;phosphoric acid?
(9,10-dioxoanthracen-2-yl)-diethyl-methylazanium;phosphoric acid has a molecular weight of 392.37 g/mol, XLogP of 2.51, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (9,10-dioxoanthracen-2-yl)-diethyl-methylazanium;phosphoric acid is sourced from PubChem (CID 22315904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).