About 6-azabicyclo[3.2.2]nonane-4,8-diamine
6-azabicyclo[3.2.2]nonane-4,8-diamine (PubChem CID 22316154) has the molecular formula C8H17N3
and a molecular weight of 155.24 g/mol. Its IUPAC name is 6-azabicyclo[3.2.2]nonane-4,8-diamine.
Molecular Properties
| Compound Name | 6-azabicyclo[3.2.2]nonane-4,8-diamine |
| PubChem CID | 22316154 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 6-azabicyclo[3.2.2]nonane-4,8-diamine |
| SMILES | NC1CC2NCC1CCC2N |
| InChI | InChI=1S/C8H17N3/c9-6-2-1-5-4-11-8(6)3-7(5)10/h5-8,11H,1-4,9-10H2 |
| InChIKey | GKILRXCKCZWNEI-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-azabicyclo[3.2.2]nonane-4,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azabicyclo[3.2.2]nonane-4,8-diamine?
The IUPAC name of 6-azabicyclo[3.2.2]nonane-4,8-diamine (CID 22316154) is 6-azabicyclo[3.2.2]nonane-4,8-diamine.
What is the SMILES notation for 6-azabicyclo[3.2.2]nonane-4,8-diamine?
The canonical SMILES for 6-azabicyclo[3.2.2]nonane-4,8-diamine is NC1CC2NCC1CCC2N.
What is the InChIKey of 6-azabicyclo[3.2.2]nonane-4,8-diamine?
The InChIKey is GKILRXCKCZWNEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3/c9-6-2-1-5-4-11-8(6)3-7(5)10/h5-8,11H,1-4,9-10H2.
What are the key properties of 6-azabicyclo[3.2.2]nonane-4,8-diamine?
6-azabicyclo[3.2.2]nonane-4,8-diamine has a molecular weight of 155.24 g/mol, XLogP of -0.59, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azabicyclo[3.2.2]nonane-4,8-diamine is sourced from PubChem (CID 22316154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).