About 3-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)propan-1-one
3-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)propan-1-one (PubChem CID 2231616) has the molecular formula C19H21NO3S
and a molecular weight of 343.45 g/mol. Its IUPAC name is 3-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)propan-1-one.
Molecular Properties
| Compound Name | 3-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)propan-1-one |
| PubChem CID | 2231616 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 3-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)propan-1-one |
| SMILES | O=C(CCS(=O)(=O)Cc1ccccc1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C19H21NO3S/c21-19(20-13-6-10-17-9-4-5-11-18(17)20)12-14-24(22,23)15-16-7-2-1-3-8-16/h1-5,7-9,11H,6,10,12-15H2 |
| InChIKey | CTJNJQSSPLZKJY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)propan-1-one?
The IUPAC name of 3-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)propan-1-one (CID 2231616) is 3-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)propan-1-one.
What is the SMILES notation for 3-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)propan-1-one?
The canonical SMILES for 3-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)propan-1-one is O=C(CCS(=O)(=O)Cc1ccccc1)N1CCCc2ccccc21.
What is the InChIKey of 3-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)propan-1-one?
The InChIKey is CTJNJQSSPLZKJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO3S/c21-19(20-13-6-10-17-9-4-5-11-18(17)20)12-14-24(22,23)15-16-7-2-1-3-8-16/h1-5,7-9,11H,6,10,12-15H2.
What are the key properties of 3-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)propan-1-one?
3-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)propan-1-one has a molecular weight of 343.45 g/mol, XLogP of 2.97, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylsulfonyl-1-(3,4-dihydro-2H-quinolin-1-yl)propan-1-one is sourced from PubChem (CID 2231616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).