C14H14N8O3 — CID 22316401
2,4-diazido-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine (PubChem CID 22316401) has the molecular formula C14H14N8O3 and a molecular weight of 342.32 g/mol. Its IUPAC name is 2,4-diazido-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine.
| Compound Name | 2,4-diazido-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine |
|---|---|
| PubChem CID | 22316401 |
| Molecular Formula | C14H14N8O3 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2,4-diazido-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine |
| SMILES | COc1cc(Cc2cnc(N=[N+]=[N-])nc2N=[N+]=[N-])cc(OC)c1OC |
| InChI | InChI=1S/C14H14N8O3/c1-23-10-5-8(6-11(24-2)12(10)25-3)4-9-7-17-14(20-22-16)18-13(9)19-21-15/h5-7H,4H2,1-3H3 |
| InChIKey | YRVGPLRZMXXQOF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 150.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|