C22H19FN2O2S2 — CID 22316693
4-[4-[2-(3-fluoro-4-methylsulfonylphenyl)-5-methylpyrrol-1-yl]-2-methylphenyl]-1,3-thiazole (PubChem CID 22316693) has the molecular formula C22H19FN2O2S2 and a molecular weight of 426.54 g/mol. Its IUPAC name is 4-[4-[2-(3-fluoro-4-methylsulfonylphenyl)-5-methylpyrrol-1-yl]-2-methylphenyl]-1,3-thiazole.
| Compound Name | 4-[4-[2-(3-fluoro-4-methylsulfonylphenyl)-5-methylpyrrol-1-yl]-2-methylphenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 22316693 |
| Molecular Formula | C22H19FN2O2S2 |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 4-[4-[2-(3-fluoro-4-methylsulfonylphenyl)-5-methylpyrrol-1-yl]-2-methylphenyl]-1,3-thiazole |
| SMILES | Cc1cc(-n2c(C)ccc2-c2ccc(S(C)(=O)=O)c(F)c2)ccc1-c1cscn1 |
| InChI | InChI=1S/C22H19FN2O2S2/c1-14-10-17(6-7-18(14)20-12-28-13-24-20)25-15(2)4-8-21(25)16-5-9-22(19(23)11-16)29(3,26)27/h4-13H,1-3H3 |
| InChIKey | WEABZQUXQSLPJY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|