C13H8F3NO3 — CID 22316772
4,4,4-trifluoro-1-[4-(1,3-oxazol-4-yl)phenyl]butane-1,3-dione (PubChem CID 22316772) has the molecular formula C13H8F3NO3 and a molecular weight of 283.20 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-[4-(1,3-oxazol-4-yl)phenyl]butane-1,3-dione.
| Compound Name | 4,4,4-trifluoro-1-[4-(1,3-oxazol-4-yl)phenyl]butane-1,3-dione |
|---|---|
| PubChem CID | 22316772 |
| Molecular Formula | C13H8F3NO3 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 4,4,4-trifluoro-1-[4-(1,3-oxazol-4-yl)phenyl]butane-1,3-dione |
| SMILES | O=C(CC(=O)C(F)(F)F)c1ccc(-c2cocn2)cc1 |
| InChI | InChI=1S/C13H8F3NO3/c14-13(15,16)12(19)5-11(18)9-3-1-8(2-4-9)10-6-20-7-17-10/h1-4,6-7H,5H2 |
| InChIKey | YYRXJWYIGLOHNW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|