C14H10F3NO3 — CID 22316778
4,4,4-trifluoro-1-[3-methyl-4-(1,3-oxazol-4-yl)phenyl]butane-1,3-dione (PubChem CID 22316778) has the molecular formula C14H10F3NO3 and a molecular weight of 297.23 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-[3-methyl-4-(1,3-oxazol-4-yl)phenyl]butane-1,3-dione.
| Compound Name | 4,4,4-trifluoro-1-[3-methyl-4-(1,3-oxazol-4-yl)phenyl]butane-1,3-dione |
|---|---|
| PubChem CID | 22316778 |
| Molecular Formula | C14H10F3NO3 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 4,4,4-trifluoro-1-[3-methyl-4-(1,3-oxazol-4-yl)phenyl]butane-1,3-dione |
| SMILES | Cc1cc(C(=O)CC(=O)C(F)(F)F)ccc1-c1cocn1 |
| InChI | InChI=1S/C14H10F3NO3/c1-8-4-9(12(19)5-13(20)14(15,16)17)2-3-10(8)11-6-21-7-18-11/h2-4,6-7H,5H2,1H3 |
| InChIKey | JJJFFHGWUBWYOY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|