About [2-amino-4-(2,2,2-trifluoroethoxy)phenyl]carbamic acid
[2-amino-4-(2,2,2-trifluoroethoxy)phenyl]carbamic acid (PubChem CID 22317236) has the molecular formula C9H9F3N2O3
and a molecular weight of 250.18 g/mol. Its IUPAC name is [2-amino-4-(2,2,2-trifluoroethoxy)phenyl]carbamic acid.
Molecular Properties
| Compound Name | [2-amino-4-(2,2,2-trifluoroethoxy)phenyl]carbamic acid |
| PubChem CID | 22317236 |
| Molecular Formula | C9H9F3N2O3 |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | [2-amino-4-(2,2,2-trifluoroethoxy)phenyl]carbamic acid |
| SMILES | Nc1cc(OCC(F)(F)F)ccc1NC(=O)O |
| InChI | InChI=1S/C9H9F3N2O3/c10-9(11,12)4-17-5-1-2-7(6(13)3-5)14-8(15)16/h1-3,14H,4,13H2,(H,15,16) |
| InChIKey | TXBIWKMYCDTGHJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [2-amino-4-(2,2,2-trifluoroethoxy)phenyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-amino-4-(2,2,2-trifluoroethoxy)phenyl]carbamic acid?
The IUPAC name of [2-amino-4-(2,2,2-trifluoroethoxy)phenyl]carbamic acid (CID 22317236) is [2-amino-4-(2,2,2-trifluoroethoxy)phenyl]carbamic acid.
What is the SMILES notation for [2-amino-4-(2,2,2-trifluoroethoxy)phenyl]carbamic acid?
The canonical SMILES for [2-amino-4-(2,2,2-trifluoroethoxy)phenyl]carbamic acid is Nc1cc(OCC(F)(F)F)ccc1NC(=O)O.
What is the InChIKey of [2-amino-4-(2,2,2-trifluoroethoxy)phenyl]carbamic acid?
The InChIKey is TXBIWKMYCDTGHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3N2O3/c10-9(11,12)4-17-5-1-2-7(6(13)3-5)14-8(15)16/h1-3,14H,4,13H2,(H,15,16).
What are the key properties of [2-amino-4-(2,2,2-trifluoroethoxy)phenyl]carbamic acid?
[2-amino-4-(2,2,2-trifluoroethoxy)phenyl]carbamic acid has a molecular weight of 250.18 g/mol, XLogP of 2.30, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-amino-4-(2,2,2-trifluoroethoxy)phenyl]carbamic acid is sourced from PubChem (CID 22317236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).