About [2-nitro-5-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]carbamic acid
[2-nitro-5-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]carbamic acid (PubChem CID 22317371) has the molecular formula C10H6F6N2O5
and a molecular weight of 348.16 g/mol. Its IUPAC name is [2-nitro-5-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]carbamic acid.
Molecular Properties
| Compound Name | [2-nitro-5-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]carbamic acid |
| PubChem CID | 22317371 |
| Molecular Formula | C10H6F6N2O5 |
| Molecular Weight | 348.16 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | [2-nitro-5-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]carbamic acid |
| SMILES | O=C(O)Nc1cc(OCC(F)(F)F)c(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H6F6N2O5/c11-9(12,13)3-23-7-2-5(17-8(19)20)6(18(21)22)1-4(7)10(14,15)16/h1-2,17H,3H2,(H,19,20) |
| InChIKey | YGHJRMGCGLYZRT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.16 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-nitro-5-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-nitro-5-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]carbamic acid?
The IUPAC name of [2-nitro-5-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]carbamic acid (CID 22317371) is [2-nitro-5-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]carbamic acid.
What is the SMILES notation for [2-nitro-5-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]carbamic acid?
The canonical SMILES for [2-nitro-5-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]carbamic acid is O=C(O)Nc1cc(OCC(F)(F)F)c(C(F)(F)F)cc1[N+](=O)[O-].
What is the InChIKey of [2-nitro-5-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]carbamic acid?
The InChIKey is YGHJRMGCGLYZRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F6N2O5/c11-9(12,13)3-23-7-2-5(17-8(19)20)6(18(21)22)1-4(7)10(14,15)16/h1-2,17H,3H2,(H,19,20).
What are the key properties of [2-nitro-5-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]carbamic acid?
[2-nitro-5-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]carbamic acid has a molecular weight of 348.16 g/mol, XLogP of 3.64, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-nitro-5-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)phenyl]carbamic acid is sourced from PubChem (CID 22317371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).